C16H13FN6 — CID 163302599
8-(2-fluorophenyl)-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,7,14-pentaene (PubChem CID 163302599) has the molecular formula C16H13FN6 and a molecular weight of 308.32 g/mol. Its IUPAC name is 8-(2-fluorophenyl)-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,7,14-pentaene.
| Compound Name | 8-(2-fluorophenyl)-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,7,14-pentaene |
|---|---|
| PubChem CID | 163302599 |
| Molecular Formula | C16H13FN6 |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 8-(2-fluorophenyl)-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,7,14-pentaene |
| SMILES | Fc1ccccc1C1=Nc2cn[nH]c2-c2cnn3c2N1CCC3 |
| InChI | InChI=1S/C16H13FN6/c17-12-5-2-1-4-10(12)15-20-13-9-18-21-14(13)11-8-19-23-7-3-6-22(15)16(11)23/h1-2,4-5,8-9H,3,6-7H2,(H,18,21) |
| InChIKey | YFZPXQKFNNVTRG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |