C17H14F2N6 — CID 163302640
(11R)-8-(2,6-difluorophenyl)-11-methyl-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,7,14-pentaene (PubChem CID 163302640) has the molecular formula C17H14F2N6 and a molecular weight of 340.34 g/mol. Its IUPAC name is (11R)-8-(2,6-difluorophenyl)-11-methyl-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,7,14-pentaene.
| Compound Name | (11R)-8-(2,6-difluorophenyl)-11-methyl-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,7,14-pentaene |
|---|---|
| PubChem CID | 163302640 |
| Molecular Formula | C17H14F2N6 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (11R)-8-(2,6-difluorophenyl)-11-methyl-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,7,14-pentaene |
| SMILES | C[C@@H]1CN2C(c3c(F)cccc3F)=Nc3cn[nH]c3-c3cnn(c32)C1 |
| InChI | InChI=1S/C17H14F2N6/c1-9-7-24-16(14-11(18)3-2-4-12(14)19)22-13-6-20-23-15(13)10-5-21-25(8-9)17(10)24/h2-6,9H,7-8H2,1H3,(H,20,23)/t9-/m1/s1 |
| InChIKey | CNNZHWZWPRLACE-SECBINFHSA-N |
| XLogP | 3.10 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |