C24H26O7 — CID 163302816
(2E,6E)-2,6-bis[[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]methylidene]cyclohexan-1-one (PubChem CID 163302816) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 163302816 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (2E,6E)-2,6-bis[[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]methylidene]cyclohexan-1-one |
| SMILES | O=C1/C(=C/c2ccc(COCC3CO3)o2)CCC/C1=C\c1ccc(COCC2CO2)o1 |
| InChI | InChI=1S/C24H26O7/c25-24-16(8-18-4-6-20(30-18)10-26-12-22-14-28-22)2-1-3-17(24)9-19-5-7-21(31-19)11-27-13-23-15-29-23/h4-9,22-23H,1-3,10-15H2/b16-8+,17-9+ |
| InChIKey | STPOSMXMYLHDCA-GONBZBRSSA-N |
| XLogP | 3.92 |
| TPSA | 86.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|