C19H29N5O3 — CID 163302852
1-[2-[amino-[(Z)-2-amino-2-phenylethenyl]amino]-3-methylbutanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide (PubChem CID 163302852) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[2-[amino-[(Z)-2-amino-2-phenylethenyl]amino]-3-methylbutanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[amino-[(Z)-2-amino-2-phenylethenyl]amino]-3-methylbutanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163302852 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-[2-[amino-[(Z)-2-amino-2-phenylethenyl]amino]-3-methylbutanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CC(O)CN1C(=O)C(C(C)C)N(N)/C=C(\N)c1ccccc1 |
| InChI | InChI=1S/C19H29N5O3/c1-12(2)17(24(21)11-15(20)13-7-5-4-6-8-13)19(27)23-10-14(25)9-16(23)18(26)22-3/h4-8,11-12,14,16-17,25H,9-10,20-21H2,1-3H3,(H,22,26)/b15-11- |
| InChIKey | BPSYLQLIRPRJSI-PTNGSMBKSA-N |
| XLogP | -0.15 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|