C17H27N7O2 — CID 163303088
1-[2-[amino-[(Z)-2-amino-2-pyrimidin-5-ylethenyl]amino]-3-methylbutanoyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 163303088) has the molecular formula C17H27N7O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-[2-[amino-[(Z)-2-amino-2-pyrimidin-5-ylethenyl]amino]-3-methylbutanoyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[amino-[(Z)-2-amino-2-pyrimidin-5-ylethenyl]amino]-3-methylbutanoyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163303088 |
| Molecular Formula | C17H27N7O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[2-[amino-[(Z)-2-amino-2-pyrimidin-5-ylethenyl]amino]-3-methylbutanoyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)C(C(C)C)N(N)/C=C(\N)c1cncnc1 |
| InChI | InChI=1S/C17H27N7O2/c1-11(2)15(17(26)23-6-4-5-14(23)16(25)20-3)24(19)9-13(18)12-7-21-10-22-8-12/h7-11,14-15H,4-6,18-19H2,1-3H3,(H,20,25)/b13-9- |
| InChIKey | GTYWJNJJIMQHNT-LCYFTJDESA-N |
| XLogP | -0.33 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|