C16H27N5O — CID 163303098
2-[amino-[(Z)-2-amino-2-(1H-pyrrol-2-yl)ethenyl]amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one (PubChem CID 163303098) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-2-(1H-pyrrol-2-yl)ethenyl]amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one.
| Compound Name | 2-[amino-[(Z)-2-amino-2-(1H-pyrrol-2-yl)ethenyl]amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 163303098 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-2-(1H-pyrrol-2-yl)ethenyl]amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one |
| SMILES | CC(C)C(C(=O)N1CCCC1C)N(N)/C=C(\N)c1ccc[nH]1 |
| InChI | InChI=1S/C16H27N5O/c1-11(2)15(16(22)20-9-5-6-12(20)3)21(18)10-13(17)14-7-4-8-19-14/h4,7-8,10-12,15,19H,5-6,9,17-18H2,1-3H3/b13-10- |
| InChIKey | OTORINXDPBJHJO-RAXLEYEMSA-N |
| XLogP | 1.48 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|