C22H31N5O2S — CID 170424045
(Z)-2-amino-1-[amino-[1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]amino]-4-methylpent-1-en-3-one (PubChem CID 170424045) has the molecular formula C22H31N5O2S and a molecular weight of 429.59 g/mol. Its IUPAC name is (Z)-2-amino-1-[amino-[1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]amino]-4-methylpent-1-en-3-one.
| Compound Name | (Z)-2-amino-1-[amino-[1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]amino]-4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 170424045 |
| Molecular Formula | C22H31N5O2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (Z)-2-amino-1-[amino-[1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]amino]-4-methylpent-1-en-3-one |
| SMILES | CC(C)C(=O)/C(N)=C/N(N)C(C(=O)N1CCCC1c1nc2ccccc2s1)C(C)C |
| InChI | InChI=1S/C22H31N5O2S/c1-13(2)19(27(24)12-15(23)20(28)14(3)4)22(29)26-11-7-9-17(26)21-25-16-8-5-6-10-18(16)30-21/h5-6,8,10,12-14,17,19H,7,9,11,23-24H2,1-4H3/b15-12- |
| InChIKey | XLIWHZBZABYVMA-QINSGFPZSA-N |
| XLogP | 3.19 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|