C15H14Cl2N2OS — CID 78769051
[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(2,2-dichlorocyclopropyl)methanone (PubChem CID 78769051) has the molecular formula C15H14Cl2N2OS and a molecular weight of 341.26 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(2,2-dichlorocyclopropyl)methanone.
| Compound Name | [2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(2,2-dichlorocyclopropyl)methanone |
|---|---|
| PubChem CID | 78769051 |
| Molecular Formula | C15H14Cl2N2OS |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(2,2-dichlorocyclopropyl)methanone |
| SMILES | O=C(C1CC1(Cl)Cl)N1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H14Cl2N2OS/c16-15(17)8-9(15)14(20)19-7-3-5-11(19)13-18-10-4-1-2-6-12(10)21-13/h1-2,4,6,9,11H,3,5,7-8H2 |
| InChIKey | QXPUDSPUOIMEAB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|