C16H16Cl2N2OS — CID 51183566
[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(2,2-dichloro-1-methylcyclopropyl)methanone (PubChem CID 51183566) has the molecular formula C16H16Cl2N2OS and a molecular weight of 355.29 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(2,2-dichloro-1-methylcyclopropyl)methanone.
| Compound Name | [2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(2,2-dichloro-1-methylcyclopropyl)methanone |
|---|---|
| PubChem CID | 51183566 |
| Molecular Formula | C16H16Cl2N2OS |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(2,2-dichloro-1-methylcyclopropyl)methanone |
| SMILES | CC1(C(=O)N2CCCC2c2nc3ccccc3s2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H16Cl2N2OS/c1-15(9-16(15,17)18)14(21)20-8-4-6-11(20)13-19-10-5-2-3-7-12(10)22-13/h2-3,5,7,11H,4,6,8-9H2,1H3 |
| InChIKey | YPBVAIQKRZPNGC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|