C25H41N5O3S — CID 170582577
2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-1-[2-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-methylbutan-1-one;ethane;methanol (PubChem CID 170582577) has the molecular formula C25H41N5O3S and a molecular weight of 491.70 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-1-[2-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-methylbutan-1-one;ethane;methanol.
| Compound Name | 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-1-[2-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-methylbutan-1-one;ethane;methanol |
|---|---|
| PubChem CID | 170582577 |
| Molecular Formula | C25H41N5O3S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-1-[2-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-methylbutan-1-one;ethane;methanol |
| SMILES | CC.CO.COc1ccc2sc(C3CCCN3C(=O)C(C(C)C)N(N)/C=C(\N)C3CC3)nc2c1 |
| InChI | InChI=1S/C22H31N5O2S.C2H6.CH4O/c1-13(2)20(27(24)12-16(23)14-6-7-14)22(28)26-10-4-5-18(26)21-25-17-11-15(29-3)8-9-19(17)30-21;2*1-2/h8-9,11-14,18,20H,4-7,10,23-24H2,1-3H3;1-2H3;2H,1H3/b16-12-;; |
| InChIKey | REMAVUQITBZQBI-DAANKRAASA-N |
| XLogP | 4.01 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|