C22H33N5O2S — CID 170582610
2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-1-[2-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-1-yl]ethanone;propane (PubChem CID 170582610) has the molecular formula C22H33N5O2S and a molecular weight of 431.61 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-1-[2-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-1-yl]ethanone;propane.
| Compound Name | 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-1-[2-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-1-yl]ethanone;propane |
|---|---|
| PubChem CID | 170582610 |
| Molecular Formula | C22H33N5O2S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-1-[2-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-1-yl]ethanone;propane |
| SMILES | CCC.COc1ccc2sc(C3CCCN3C(=O)CN(N)/C=C(\N)C3CC3)nc2c1 |
| InChI | InChI=1S/C19H25N5O2S.C3H8/c1-26-13-6-7-17-15(9-13)22-19(27-17)16-3-2-8-24(16)18(25)11-23(21)10-14(20)12-4-5-12;1-3-2/h6-7,9-10,12,16H,2-5,8,11,20-21H2,1H3;3H2,1-2H3/b14-10-; |
| InChIKey | UQYLPYVARBVTGP-DZOOLQPHSA-N |
| XLogP | 3.77 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|