C25H43N5O2S — CID 170582523
(Z)-2-amino-1-[amino-(1-hydroxy-3-methylbutan-2-yl)amino]-4-methylpent-1-en-3-one;ethane;2-(1-methylpyrrolidin-2-yl)-1,3-benzothiazole (PubChem CID 170582523) has the molecular formula C25H43N5O2S and a molecular weight of 477.72 g/mol. Its IUPAC name is (Z)-2-amino-1-[amino-(1-hydroxy-3-methylbutan-2-yl)amino]-4-methylpent-1-en-3-one;ethane;2-(1-methylpyrrolidin-2-yl)-1,3-benzothiazole.
| Compound Name | (Z)-2-amino-1-[amino-(1-hydroxy-3-methylbutan-2-yl)amino]-4-methylpent-1-en-3-one;ethane;2-(1-methylpyrrolidin-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 170582523 |
| Molecular Formula | C25H43N5O2S |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | (Z)-2-amino-1-[amino-(1-hydroxy-3-methylbutan-2-yl)amino]-4-methylpent-1-en-3-one;ethane;2-(1-methylpyrrolidin-2-yl)-1,3-benzothiazole |
| SMILES | CC.CC(C)C(=O)/C(N)=C/N(N)C(CO)C(C)C.CN1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14N2S.C11H23N3O2.C2H6/c1-14-8-4-6-10(14)12-13-9-5-2-3-7-11(9)15-12;1-7(2)10(6-15)14(13)5-9(12)11(16)8(3)4;1-2/h2-3,5,7,10H,4,6,8H2,1H3;5,7-8,10,15H,6,12-13H2,1-4H3;1-2H3/b;9-5-; |
| InChIKey | WLLLXHCNBBKKCJ-PJDKWVILSA-N |
| XLogP | 4.29 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|