C23H31N5OS2 — CID 170582554
(Z)-2-[amino(3-methylbutan-2-yl)amino]-1-thiophen-2-ylethenamine;2-(1,3-benzothiazol-2-yl)pyrrolidine-1-carbaldehyde (PubChem CID 170582554) has the molecular formula C23H31N5OS2 and a molecular weight of 457.67 g/mol. Its IUPAC name is (Z)-2-[amino(3-methylbutan-2-yl)amino]-1-thiophen-2-ylethenamine;2-(1,3-benzothiazol-2-yl)pyrrolidine-1-carbaldehyde.
| Compound Name | (Z)-2-[amino(3-methylbutan-2-yl)amino]-1-thiophen-2-ylethenamine;2-(1,3-benzothiazol-2-yl)pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 170582554 |
| Molecular Formula | C23H31N5OS2 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (Z)-2-[amino(3-methylbutan-2-yl)amino]-1-thiophen-2-ylethenamine;2-(1,3-benzothiazol-2-yl)pyrrolidine-1-carbaldehyde |
| SMILES | CC(C)C(C)N(N)/C=C(\N)c1cccs1.O=CN1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H12N2OS.C11H19N3S/c15-8-14-7-3-5-10(14)12-13-9-4-1-2-6-11(9)16-12;1-8(2)9(3)14(13)7-10(12)11-5-4-6-15-11/h1-2,4,6,8,10H,3,5,7H2;4-9H,12-13H2,1-3H3/b;10-7- |
| InChIKey | XSRBXHDXTFQBFU-QYCSVTBISA-N |
| XLogP | 4.82 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|