C12H14BrNO2 — CID 163303279
(3R)-3-(3-bromo-4-methylphenyl)-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 163303279) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is (3R)-3-(3-bromo-4-methylphenyl)-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | (3R)-3-(3-bromo-4-methylphenyl)-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 163303279 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (3R)-3-(3-bromo-4-methylphenyl)-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | Cc1ccc([C@]2(O)CCN(C)C2=O)cc1Br |
| InChI | InChI=1S/C12H14BrNO2/c1-8-3-4-9(7-10(8)13)12(16)5-6-14(2)11(12)15/h3-4,7,16H,5-6H2,1-2H3/t12-/m1/s1 |
| InChIKey | UZSFTCBEOGSMHS-GFCCVEGCSA-N |
| XLogP | 1.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |