C9H10BrNO2S — CID 178130983
3-(5-bromothiophen-2-yl)-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 178130983) has the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | 3-(5-bromothiophen-2-yl)-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 178130983 |
| Molecular Formula | C9H10BrNO2S |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(O)(c2ccc(Br)s2)C1=O |
| InChI | InChI=1S/C9H10BrNO2S/c1-11-5-4-9(13,8(11)12)6-2-3-7(10)14-6/h2-3,13H,4-5H2,1H3 |
| InChIKey | GWGMUVQNFGWNIB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |