C9H11BrN2OS — CID 116847298
1-(5-bromothiophen-2-yl)-N'-methylcyclopropane-1-carbohydrazide (PubChem CID 116847298) has the molecular formula C9H11BrN2OS and a molecular weight of 275.17 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N'-methylcyclopropane-1-carbohydrazide.
| Compound Name | 1-(5-bromothiophen-2-yl)-N'-methylcyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 116847298 |
| Molecular Formula | C9H11BrN2OS |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N'-methylcyclopropane-1-carbohydrazide |
| SMILES | CNNC(=O)C1(c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C9H11BrN2OS/c1-11-12-8(13)9(4-5-9)6-2-3-7(10)14-6/h2-3,11H,4-5H2,1H3,(H,12,13) |
| InChIKey | XQRXZJODZFHMSW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|