C15H14BrNO3 — CID 163303229
(3R)-3-[3-(4-bromofuran-2-yl)phenyl]-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 163303229) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is (3R)-3-[3-(4-bromofuran-2-yl)phenyl]-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | (3R)-3-[3-(4-bromofuran-2-yl)phenyl]-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 163303229 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (3R)-3-[3-(4-bromofuran-2-yl)phenyl]-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | CN1CC[C@@](O)(c2cccc(-c3cc(Br)co3)c2)C1=O |
| InChI | InChI=1S/C15H14BrNO3/c1-17-6-5-15(19,14(17)18)11-4-2-3-10(7-11)13-8-12(16)9-20-13/h2-4,7-9,19H,5-6H2,1H3/t15-/m1/s1 |
| InChIKey | BDSMQWVNERGDKW-OAHLLOKOSA-N |
| XLogP | 2.76 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |