C16H25N3O3 — CID 163309505
(3S,4S)-3-hydroxy-1-[(1-prop-2-enylpyrazol-4-yl)methyl]-4-propylpiperidine-4-carboxylic acid (PubChem CID 163309505) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3S,4S)-3-hydroxy-1-[(1-prop-2-enylpyrazol-4-yl)methyl]-4-propylpiperidine-4-carboxylic acid.
| Compound Name | (3S,4S)-3-hydroxy-1-[(1-prop-2-enylpyrazol-4-yl)methyl]-4-propylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 163309505 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3S,4S)-3-hydroxy-1-[(1-prop-2-enylpyrazol-4-yl)methyl]-4-propylpiperidine-4-carboxylic acid |
| SMILES | C=CCn1cc(CN2CC[C@](CCC)(C(=O)O)[C@H](O)C2)cn1 |
| InChI | InChI=1S/C16H25N3O3/c1-3-5-16(15(21)22)6-8-18(12-14(16)20)10-13-9-17-19(11-13)7-4-2/h4,9,11,14,20H,2-3,5-8,10,12H2,1H3,(H,21,22)/t14-,16+/m1/s1 |
| InChIKey | SGTGEDDYCNFVSZ-ZBFHGGJFSA-N |
| XLogP | 1.51 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|