C24H34N4 — CID 97151516
(4S)-2-ethyl-4-phenyl-9-[(1-prop-2-enylpyrazol-4-yl)methyl]-2,9-diazaspiro[5.5]undecane (PubChem CID 97151516) has the molecular formula C24H34N4 and a molecular weight of 378.56 g/mol. Its IUPAC name is (4S)-2-ethyl-4-phenyl-9-[(1-prop-2-enylpyrazol-4-yl)methyl]-2,9-diazaspiro[5.5]undecane.
| Compound Name | (4S)-2-ethyl-4-phenyl-9-[(1-prop-2-enylpyrazol-4-yl)methyl]-2,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 97151516 |
| Molecular Formula | C24H34N4 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (4S)-2-ethyl-4-phenyl-9-[(1-prop-2-enylpyrazol-4-yl)methyl]-2,9-diazaspiro[5.5]undecane |
| SMILES | C=CCn1cc(CN2CCC3(CC2)C[C@@H](c2ccccc2)CN(CC)C3)cn1 |
| InChI | InChI=1S/C24H34N4/c1-3-12-28-18-21(16-25-28)17-27-13-10-24(11-14-27)15-23(19-26(4-2)20-24)22-8-6-5-7-9-22/h3,5-9,16,18,23H,1,4,10-15,17,19-20H2,2H3/t23-/m1/s1 |
| InChIKey | NAELDGQXDKGMQY-HSZRJFAPSA-N |
| XLogP | 4.16 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|