C14H18N4O6 — CID 163309655
dimethyl (1R,5S)-3-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylate (PubChem CID 163309655) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is dimethyl (1R,5S)-3-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylate.
| Compound Name | dimethyl (1R,5S)-3-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 163309655 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | dimethyl (1R,5S)-3-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylate |
| SMILES | COC(=O)[C@@]12CN(C(=O)CCc3n[nH]c(=O)[nH]3)C[C@]1(C(=O)OC)C2 |
| InChI | InChI=1S/C14H18N4O6/c1-23-10(20)13-5-14(13,11(21)24-2)7-18(6-13)9(19)4-3-8-15-12(22)17-16-8/h3-7H2,1-2H3,(H2,15,16,17,22)/t13-,14+ |
| InChIKey | FIHPNUSJCHETQI-OKILXGFUSA-N |
| XLogP | -1.40 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |