C12H13ClN2O4 — CID 163309800
(3aS,6aR)-5-[3-(3-chloro-1,2-oxazol-5-yl)propanoyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3-one (PubChem CID 163309800) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is (3aS,6aR)-5-[3-(3-chloro-1,2-oxazol-5-yl)propanoyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3-one.
| Compound Name | (3aS,6aR)-5-[3-(3-chloro-1,2-oxazol-5-yl)propanoyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 163309800 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (3aS,6aR)-5-[3-(3-chloro-1,2-oxazol-5-yl)propanoyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3-one |
| SMILES | O=C1OC[C@H]2CN(C(=O)CCc3cc(Cl)no3)C[C@@H]12 |
| InChI | InChI=1S/C12H13ClN2O4/c13-10-3-8(19-14-10)1-2-11(16)15-4-7-6-18-12(17)9(7)5-15/h3,7,9H,1-2,4-6H2/t7-,9-/m1/s1 |
| InChIKey | UHCYLHGAPPUOII-VXNVDRBHSA-N |
| XLogP | 0.89 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |