C14H17ClN4O4 — CID 95144493
(9aS)-2-[3-(3-chloro-1,2-oxazol-5-yl)propanoyl]-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 95144493) has the molecular formula C14H17ClN4O4 and a molecular weight of 340.77 g/mol. Its IUPAC name is (9aS)-2-[3-(3-chloro-1,2-oxazol-5-yl)propanoyl]-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aS)-2-[3-(3-chloro-1,2-oxazol-5-yl)propanoyl]-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 95144493 |
| Molecular Formula | C14H17ClN4O4 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (9aS)-2-[3-(3-chloro-1,2-oxazol-5-yl)propanoyl]-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CN1CC(=O)N2CCN(C(=O)CCc3cc(Cl)no3)C[C@H]2C1=O |
| InChI | InChI=1S/C14H17ClN4O4/c1-17-8-13(21)19-5-4-18(7-10(19)14(17)22)12(20)3-2-9-6-11(15)16-23-9/h6,10H,2-5,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | YSLAGWJBKPDPPC-JTQLQIEISA-N |
| XLogP | -0.23 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |