C20H20N4O3S — CID 163311368
1-[4-(1,6-naphthyridin-5-yl)benzoyl]piperidine-4-sulfonamide (PubChem CID 163311368) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-[4-(1,6-naphthyridin-5-yl)benzoyl]piperidine-4-sulfonamide.
| Compound Name | 1-[4-(1,6-naphthyridin-5-yl)benzoyl]piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 163311368 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-[4-(1,6-naphthyridin-5-yl)benzoyl]piperidine-4-sulfonamide |
| SMILES | NS(=O)(=O)C1CCN(C(=O)c2ccc(-c3nccc4ncccc34)cc2)CC1 |
| InChI | InChI=1S/C20H20N4O3S/c21-28(26,27)16-8-12-24(13-9-16)20(25)15-5-3-14(4-6-15)19-17-2-1-10-22-18(17)7-11-23-19/h1-7,10-11,16H,8-9,12-13H2,(H2,21,26,27) |
| InChIKey | ANTJAGJKDNNUQQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |