C25H37N3O2 — CID 163314697
3-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-6-methyl-1H-pyridin-2-one (PubChem CID 163314697) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 3-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-6-methyl-1H-pyridin-2-one.
| Compound Name | 3-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 163314697 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 3-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](CC2CCCCC2)N2CCCC[C@@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C25H37N3O2/c1-17-10-11-21(24(29)26-17)25(30)27-15-19-14-20(16-27)23(13-18-7-3-2-4-8-18)28-12-6-5-9-22(19)28/h10-11,18-20,22-23H,2-9,12-16H2,1H3,(H,26,29)/t19-,20+,22+,23+/m1/s1 |
| InChIKey | SALXPCJGYOIWRS-VAPSRWTKSA-N |
| XLogP | 3.97 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |