C16H16ClF3N4O — CID 163317865
(5S)-7-[(2-chlorophenyl)methyl]-5-methyl-3-(3,3,3-trifluoropropyl)-5,8-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-6-one (PubChem CID 163317865) has the molecular formula C16H16ClF3N4O and a molecular weight of 372.78 g/mol. Its IUPAC name is (5S)-7-[(2-chlorophenyl)methyl]-5-methyl-3-(3,3,3-trifluoropropyl)-5,8-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-6-one.
| Compound Name | (5S)-7-[(2-chlorophenyl)methyl]-5-methyl-3-(3,3,3-trifluoropropyl)-5,8-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-6-one |
|---|---|
| PubChem CID | 163317865 |
| Molecular Formula | C16H16ClF3N4O |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (5S)-7-[(2-chlorophenyl)methyl]-5-methyl-3-(3,3,3-trifluoropropyl)-5,8-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-6-one |
| SMILES | C[C@H]1C(=O)N(Cc2ccccc2Cl)Cc2nnc(CCC(F)(F)F)n21 |
| InChI | InChI=1S/C16H16ClF3N4O/c1-10-15(25)23(8-11-4-2-3-5-12(11)17)9-14-22-21-13(24(10)14)6-7-16(18,19)20/h2-5,10H,6-9H2,1H3/t10-/m0/s1 |
| InChIKey | XQXAJDLXBSTAFN-JTQLQIEISA-N |
| XLogP | 3.53 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |