C18H24FN5O2 — CID 163318125
4-[5-(4-fluorophenyl)tetrazol-2-yl]-N-(4-methoxycyclohexyl)butanamide (PubChem CID 163318125) has the molecular formula C18H24FN5O2 and a molecular weight of 361.42 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)tetrazol-2-yl]-N-(4-methoxycyclohexyl)butanamide.
| Compound Name | 4-[5-(4-fluorophenyl)tetrazol-2-yl]-N-(4-methoxycyclohexyl)butanamide |
|---|---|
| PubChem CID | 163318125 |
| Molecular Formula | C18H24FN5O2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 4-[5-(4-fluorophenyl)tetrazol-2-yl]-N-(4-methoxycyclohexyl)butanamide |
| SMILES | COC1CCC(NC(=O)CCCn2nnc(-c3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C18H24FN5O2/c1-26-16-10-8-15(9-11-16)20-17(25)3-2-12-24-22-18(21-23-24)13-4-6-14(19)7-5-13/h4-7,15-16H,2-3,8-12H2,1H3,(H,20,25) |
| InChIKey | HWPOVMVZVDLBCN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |