C22H32N6O — CID 86904326
N-(1-cyclohexylpiperidin-3-yl)-4-(5-phenyltetrazol-2-yl)butanamide (PubChem CID 86904326) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is N-(1-cyclohexylpiperidin-3-yl)-4-(5-phenyltetrazol-2-yl)butanamide.
| Compound Name | N-(1-cyclohexylpiperidin-3-yl)-4-(5-phenyltetrazol-2-yl)butanamide |
|---|---|
| PubChem CID | 86904326 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | N-(1-cyclohexylpiperidin-3-yl)-4-(5-phenyltetrazol-2-yl)butanamide |
| SMILES | O=C(CCCn1nnc(-c2ccccc2)n1)NC1CCCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C22H32N6O/c29-21(23-19-11-7-15-27(17-19)20-12-5-2-6-13-20)14-8-16-28-25-22(24-26-28)18-9-3-1-4-10-18/h1,3-4,9-10,19-20H,2,5-8,11-17H2,(H,23,29) |
| InChIKey | MPMHAKXZOUUNGE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |