C25H30N6O2 — CID 86874567
N-[3-[[4-(5-phenyltetrazol-2-yl)butanoylamino]methyl]phenyl]cyclohexanecarboxamide (PubChem CID 86874567) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is N-[3-[[4-(5-phenyltetrazol-2-yl)butanoylamino]methyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[4-(5-phenyltetrazol-2-yl)butanoylamino]methyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 86874567 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[3-[[4-(5-phenyltetrazol-2-yl)butanoylamino]methyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(CCCn1nnc(-c2ccccc2)n1)NCc1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H30N6O2/c32-23(15-8-16-31-29-24(28-30-31)20-10-3-1-4-11-20)26-18-19-9-7-14-22(17-19)27-25(33)21-12-5-2-6-13-21/h1,3-4,7,9-11,14,17,21H,2,5-6,8,12-13,15-16,18H2,(H,26,32)(H,27,33) |
| InChIKey | CCSGJEXFCGDOBG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |