C16H19F3N2O2S — CID 55894428
N-[3-[[[2-(trifluoromethylsulfanyl)acetyl]amino]methyl]phenyl]cyclopentanecarboxamide (PubChem CID 55894428) has the molecular formula C16H19F3N2O2S and a molecular weight of 360.40 g/mol. Its IUPAC name is N-[3-[[[2-(trifluoromethylsulfanyl)acetyl]amino]methyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[[2-(trifluoromethylsulfanyl)acetyl]amino]methyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 55894428 |
| Molecular Formula | C16H19F3N2O2S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[3-[[[2-(trifluoromethylsulfanyl)acetyl]amino]methyl]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(CSC(F)(F)F)NCc1cccc(NC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C16H19F3N2O2S/c17-16(18,19)24-10-14(22)20-9-11-4-3-7-13(8-11)21-15(23)12-5-1-2-6-12/h3-4,7-8,12H,1-2,5-6,9-10H2,(H,20,22)(H,21,23) |
| InChIKey | COYNVZVWDXAITK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |