C22H20N6O3 — CID 86874612
N-[3-[4-(5-phenyltetrazol-2-yl)butanoylamino]phenyl]furan-3-carboxamide (PubChem CID 86874612) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is N-[3-[4-(5-phenyltetrazol-2-yl)butanoylamino]phenyl]furan-3-carboxamide.
| Compound Name | N-[3-[4-(5-phenyltetrazol-2-yl)butanoylamino]phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 86874612 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[3-[4-(5-phenyltetrazol-2-yl)butanoylamino]phenyl]furan-3-carboxamide |
| SMILES | O=C(CCCn1nnc(-c2ccccc2)n1)Nc1cccc(NC(=O)c2ccoc2)c1 |
| InChI | InChI=1S/C22H20N6O3/c29-20(10-5-12-28-26-21(25-27-28)16-6-2-1-3-7-16)23-18-8-4-9-19(14-18)24-22(30)17-11-13-31-15-17/h1-4,6-9,11,13-15H,5,10,12H2,(H,23,29)(H,24,30) |
| InChIKey | WIAHVYLAASHGOD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |