C16H30N2OS — CID 45243625
N-(1-cycloheptylpiperidin-3-yl)-3-methylsulfanylpropanamide (PubChem CID 45243625) has the molecular formula C16H30N2OS and a molecular weight of 298.50 g/mol. Its IUPAC name is N-(1-cycloheptylpiperidin-3-yl)-3-methylsulfanylpropanamide.
| Compound Name | N-(1-cycloheptylpiperidin-3-yl)-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 45243625 |
| Molecular Formula | C16H30N2OS |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | N-(1-cycloheptylpiperidin-3-yl)-3-methylsulfanylpropanamide |
| SMILES | CSCCC(=O)NC1CCCN(C2CCCCCC2)C1 |
| InChI | InChI=1S/C16H30N2OS/c1-20-12-10-16(19)17-14-7-6-11-18(13-14)15-8-4-2-3-5-9-15/h14-15H,2-13H2,1H3,(H,17,19) |
| InChIKey | BKHQYQKPAZNUKQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |