C21H18ClN5O3 — CID 163325616
N-[(E)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-benzimidazol-2-amine;hydrochloride (PubChem CID 163325616) has the molecular formula C21H18ClN5O3 and a molecular weight of 423.86 g/mol. Its IUPAC name is N-[(E)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-benzimidazol-2-amine;hydrochloride.
| Compound Name | N-[(E)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-benzimidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 163325616 |
| Molecular Formula | C21H18ClN5O3 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[(E)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-benzimidazol-2-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(COc2cccc(/C=N/Nc3nc4ccccc4[nH]3)c2)cc1 |
| InChI | InChI=1S/C21H17N5O3.ClH/c27-26(28)17-10-8-15(9-11-17)14-29-18-5-3-4-16(12-18)13-22-25-21-23-19-6-1-2-7-20(19)24-21;/h1-13H,14H2,(H2,23,24,25);1H/b22-13+; |
| InChIKey | GDXQSRDYIKVOSX-PNAHYYPNSA-N |
| XLogP | 4.92 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|