C32H32ClN3O3 — CID 163326563
methyl 4-(4-benzylpiperazin-1-yl)-3-[(4-phenylbenzoyl)amino]benzoate;hydrochloride (PubChem CID 163326563) has the molecular formula C32H32ClN3O3 and a molecular weight of 542.08 g/mol. Its IUPAC name is methyl 4-(4-benzylpiperazin-1-yl)-3-[(4-phenylbenzoyl)amino]benzoate;hydrochloride.
| Compound Name | methyl 4-(4-benzylpiperazin-1-yl)-3-[(4-phenylbenzoyl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 163326563 |
| Molecular Formula | C32H32ClN3O3 |
| Molecular Weight | 542.08 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | methyl 4-(4-benzylpiperazin-1-yl)-3-[(4-phenylbenzoyl)amino]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(N2CCN(Cc3ccccc3)CC2)c(NC(=O)c2ccc(-c3ccccc3)cc2)c1.Cl |
| InChI | InChI=1S/C32H31N3O3.ClH/c1-38-32(37)28-16-17-30(35-20-18-34(19-21-35)23-24-8-4-2-5-9-24)29(22-28)33-31(36)27-14-12-26(13-15-27)25-10-6-3-7-11-25;/h2-17,22H,18-21,23H2,1H3,(H,33,36);1H |
| InChIKey | ALSXZWIVKYVGNX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.08 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |