C31H37N3O4 — CID 43913840
ethyl 4-(4-benzylpiperazin-1-yl)-3-[(4-butan-2-yloxybenzoyl)amino]benzoate (PubChem CID 43913840) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is ethyl 4-(4-benzylpiperazin-1-yl)-3-[(4-butan-2-yloxybenzoyl)amino]benzoate.
| Compound Name | ethyl 4-(4-benzylpiperazin-1-yl)-3-[(4-butan-2-yloxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 43913840 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | ethyl 4-(4-benzylpiperazin-1-yl)-3-[(4-butan-2-yloxybenzoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(Cc3ccccc3)CC2)c(NC(=O)c2ccc(OC(C)CC)cc2)c1 |
| InChI | InChI=1S/C31H37N3O4/c1-4-23(3)38-27-14-11-25(12-15-27)30(35)32-28-21-26(31(36)37-5-2)13-16-29(28)34-19-17-33(18-20-34)22-24-9-7-6-8-10-24/h6-16,21,23H,4-5,17-20,22H2,1-3H3,(H,32,35) |
| InChIKey | MMRVOMCQJPQMJH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |