C21H26N2O5 — CID 163327630
4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid (PubChem CID 163327630) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid.
| Compound Name | 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid |
|---|---|
| PubChem CID | 163327630 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid |
| SMILES | Cc1cccc(N2CCN(Cc3ccc(O)cc3)CC2)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N2O.C2H2O4/c1-15-4-3-5-19(16(15)2)21-12-10-20(11-13-21)14-17-6-8-18(22)9-7-17;3-1(4)2(5)6/h3-9,22H,10-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | JEJRCYIHTFXYJU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|