C23H33N3 — CID 2845785
4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-N,N-diethylaniline (PubChem CID 2845785) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-N,N-diethylaniline.
| Compound Name | 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 2845785 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CN2CCN(c3cccc(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C23H33N3/c1-5-25(6-2)22-12-10-21(11-13-22)18-24-14-16-26(17-15-24)23-9-7-8-19(3)20(23)4/h7-13H,5-6,14-18H2,1-4H3 |
| InChIKey | ZLXSJRUVGHXWSH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|