C22H23N5O6 — CID 163327768
4-[3-methyl-5-(propanoylamino)pyrazol-1-yl]-N-(pyridin-2-ylmethyl)benzamide;oxalic acid (PubChem CID 163327768) has the molecular formula C22H23N5O6 and a molecular weight of 453.46 g/mol. Its IUPAC name is 4-[3-methyl-5-(propanoylamino)pyrazol-1-yl]-N-(pyridin-2-ylmethyl)benzamide;oxalic acid.
| Compound Name | 4-[3-methyl-5-(propanoylamino)pyrazol-1-yl]-N-(pyridin-2-ylmethyl)benzamide;oxalic acid |
|---|---|
| PubChem CID | 163327768 |
| Molecular Formula | C22H23N5O6 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 4-[3-methyl-5-(propanoylamino)pyrazol-1-yl]-N-(pyridin-2-ylmethyl)benzamide;oxalic acid |
| SMILES | CCC(=O)Nc1cc(C)nn1-c1ccc(C(=O)NCc2ccccn2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H21N5O2.C2H2O4/c1-3-19(26)23-18-12-14(2)24-25(18)17-9-7-15(8-10-17)20(27)22-13-16-6-4-5-11-21-16;3-1(4)2(5)6/h4-12H,3,13H2,1-2H3,(H,22,27)(H,23,26);(H,3,4)(H,5,6) |
| InChIKey | SVWJSYVWGUIQQG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|