C16H17ClN2O2S — CID 163329108
2-hydroxy-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]-2-phenylacetamide;hydrochloride (PubChem CID 163329108) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]-2-phenylacetamide;hydrochloride.
| Compound Name | 2-hydroxy-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 163329108 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-hydroxy-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]-2-phenylacetamide;hydrochloride |
| SMILES | CSc1ccc(/C=N/NC(=O)C(O)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C16H16N2O2S.ClH/c1-21-14-9-7-12(8-10-14)11-17-18-16(20)15(19)13-5-3-2-4-6-13;/h2-11,15,19H,1H3,(H,18,20);1H/b17-11+; |
| InChIKey | OHFPCUZMBHVXRR-SJDTYFKWSA-N |
| XLogP | 3.01 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|