C15H13ClN4S — CID 163329153
2-(1H-benzimidazol-2-ylmethylsulfanyl)-6-methylpyridine-3-carbonitrile;hydrochloride (PubChem CID 163329153) has the molecular formula C15H13ClN4S and a molecular weight of 316.82 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-6-methylpyridine-3-carbonitrile;hydrochloride.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-6-methylpyridine-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 163329153 |
| Molecular Formula | C15H13ClN4S |
| Molecular Weight | 316.82 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-6-methylpyridine-3-carbonitrile;hydrochloride |
| SMILES | Cc1ccc(C#N)c(SCc2nc3ccccc3[nH]2)n1.Cl |
| InChI | InChI=1S/C15H12N4S.ClH/c1-10-6-7-11(8-16)15(17-10)20-9-14-18-12-4-2-3-5-13(12)19-14;/h2-7H,9H2,1H3,(H,18,19);1H |
| InChIKey | KEWHFLQNTJWGSG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |