C19H12ClN5S — CID 46703322
2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-chloro-6-phenylpyrimidine-5-carbonitrile (PubChem CID 46703322) has the molecular formula C19H12ClN5S and a molecular weight of 377.86 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-chloro-6-phenylpyrimidine-5-carbonitrile.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-chloro-6-phenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 46703322 |
| Molecular Formula | C19H12ClN5S |
| Molecular Weight | 377.86 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-chloro-6-phenylpyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(Cl)nc(SCc2nc3ccccc3[nH]2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H12ClN5S/c20-18-13(10-21)17(12-6-2-1-3-7-12)24-19(25-18)26-11-16-22-14-8-4-5-9-15(14)23-16/h1-9H,11H2,(H,22,23) |
| InChIKey | FMPUMVVGQUGVBT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.86 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |