C19H14N6O — CID 137206090
2-(1H-benzimidazol-2-ylmethylamino)-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 137206090) has the molecular formula C19H14N6O and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylamino)-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylamino)-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 137206090 |
| Molecular Formula | C19H14N6O |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylamino)-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NCc2nc3ccccc3[nH]2)[nH]c1=O |
| InChI | InChI=1S/C19H14N6O/c20-10-13-17(12-6-2-1-3-7-12)24-19(25-18(13)26)21-11-16-22-14-8-4-5-9-15(14)23-16/h1-9H,11H2,(H,22,23)(H2,21,24,25,26) |
| InChIKey | JVFGKJZYRIHMJN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|