C17H13N5O4 — CID 137206092
2-(1H-benzimidazol-2-ylmethylamino)-4-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 137206092) has the molecular formula C17H13N5O4 and a molecular weight of 351.32 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylamino)-4-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylamino)-4-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 137206092 |
| Molecular Formula | C17H13N5O4 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylamino)-4-(furan-2-yl)-6-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccco2)nc(NCc2nc3ccccc3[nH]2)[nH]c1=O |
| InChI | InChI=1S/C17H13N5O4/c23-15-13(16(24)25)14(11-6-3-7-26-11)21-17(22-15)18-8-12-19-9-4-1-2-5-10(9)20-12/h1-7H,8H2,(H,19,20)(H,24,25)(H2,18,21,22,23) |
| InChIKey | GCHONIZZOCUZPS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |