C23H12N6 — CID 132514774
2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile (PubChem CID 132514774) has the molecular formula C23H12N6 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 132514774 |
| Molecular Formula | C23H12N6 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile |
| SMILES | N#Cc1ccc2nc(-c3nc4ccccc4[nH]3)c(-c3ccccc3)nc2c1C#N |
| InChI | InChI=1S/C23H12N6/c24-12-15-10-11-19-21(16(15)13-25)29-20(14-6-2-1-3-7-14)22(26-19)23-27-17-8-4-5-9-18(17)28-23/h1-11H,(H,27,28) |
| InChIKey | FTXWLTGUDNWXAA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |