About 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile
2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile (PubChem CID 132514774) has the molecular formula C23H12N6
and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile |
| PubChem CID | 132514774 |
| Molecular Formula | C23H12N6 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile |
| SMILES | N#Cc1ccc2nc(-c3nc4ccccc4[nH]3)c(-c3ccccc3)nc2c1C#N |
| InChI | InChI=1S/C23H12N6/c24-12-15-10-11-19-21(16(15)13-25)29-20(14-6-2-1-3-7-14)22(26-19)23-27-17-8-4-5-9-18(17)28-23/h1-11H,(H,27,28) |
| InChIKey | FTXWLTGUDNWXAA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile?
The IUPAC name of 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile (CID 132514774) is 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile.
What is the SMILES notation for 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile?
The canonical SMILES for 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile is N#Cc1ccc2nc(-c3nc4ccccc4[nH]3)c(-c3ccccc3)nc2c1C#N.
What is the InChIKey of 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile?
The InChIKey is FTXWLTGUDNWXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H12N6/c24-12-15-10-11-19-21(16(15)13-25)29-20(14-6-2-1-3-7-14)22(26-19)23-27-17-8-4-5-9-18(17)28-23/h1-11H,(H,27,28).
What are the key properties of 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile?
2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile has a molecular weight of 372.39 g/mol, XLogP of 4.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-benzimidazol-2-yl)-3-phenylquinoxaline-5,6-dicarbonitrile is sourced from PubChem (CID 132514774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).