C24H18FN5S — CID 118709723
2-(1H-benzimidazol-2-ylmethylsulfanyl)-N-(2-fluorophenyl)-6-phenylpyrimidin-4-amine (PubChem CID 118709723) has the molecular formula C24H18FN5S and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-N-(2-fluorophenyl)-6-phenylpyrimidin-4-amine.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-N-(2-fluorophenyl)-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 118709723 |
| Molecular Formula | C24H18FN5S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-N-(2-fluorophenyl)-6-phenylpyrimidin-4-amine |
| SMILES | Fc1ccccc1Nc1cc(-c2ccccc2)nc(SCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C24H18FN5S/c25-17-10-4-5-11-18(17)26-22-14-21(16-8-2-1-3-9-16)29-24(30-22)31-15-23-27-19-12-6-7-13-20(19)28-23/h1-14H,15H2,(H,27,28)(H,26,29,30) |
| InChIKey | ZAYXZOPWAPMRNN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |