C21H24ClN3O5 — CID 163329175
[4-[(E)-[(2-morpholin-4-ylacetyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate;hydrochloride (PubChem CID 163329175) has the molecular formula C21H24ClN3O5 and a molecular weight of 433.89 g/mol. Its IUPAC name is [4-[(E)-[(2-morpholin-4-ylacetyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate;hydrochloride.
| Compound Name | [4-[(E)-[(2-morpholin-4-ylacetyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 163329175 |
| Molecular Formula | C21H24ClN3O5 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [4-[(E)-[(2-morpholin-4-ylacetyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate;hydrochloride |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=N/NC(=O)CN3CCOCC3)cc2)cc1.Cl |
| InChI | InChI=1S/C21H23N3O5.ClH/c1-27-18-8-4-17(5-9-18)21(26)29-19-6-2-16(3-7-19)14-22-23-20(25)15-24-10-12-28-13-11-24;/h2-9,14H,10-13,15H2,1H3,(H,23,25);1H/b22-14+; |
| InChIKey | QTSYWLCIGJYBTB-CWUUNJJBSA-N |
| XLogP | 2.12 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|