C26H33ClN2O6 — CID 163330122
(4E)-1-[2-(diethylamino)ethyl]-4-[hydroxy(phenyl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride (PubChem CID 163330122) has the molecular formula C26H33ClN2O6 and a molecular weight of 505.01 g/mol. Its IUPAC name is (4E)-1-[2-(diethylamino)ethyl]-4-[hydroxy(phenyl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride.
| Compound Name | (4E)-1-[2-(diethylamino)ethyl]-4-[hydroxy(phenyl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 163330122 |
| Molecular Formula | C26H33ClN2O6 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (4E)-1-[2-(diethylamino)ethyl]-4-[hydroxy(phenyl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride |
| SMILES | CCN(CC)CCN1C(=O)C(=O)/C(=C(/O)c2ccccc2)C1c1cc(OC)c(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C26H32N2O6.ClH/c1-6-27(7-2)13-14-28-22(18-15-19(32-3)25(34-5)20(16-18)33-4)21(24(30)26(28)31)23(29)17-11-9-8-10-12-17;/h8-12,15-16,22,29H,6-7,13-14H2,1-5H3;1H/b23-21+; |
| InChIKey | CBTBXTRVTUHORP-FKWCIMQXSA-N |
| XLogP | 3.90 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|