C26H31BrN2O7 — CID 73263898
4-[(5-bromo-2-hydroxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 73263898) has the molecular formula C26H31BrN2O7 and a molecular weight of 563.45 g/mol. Its IUPAC name is 4-[(5-bromo-2-hydroxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(5-bromo-2-hydroxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 73263898 |
| Molecular Formula | C26H31BrN2O7 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 4-[(5-bromo-2-hydroxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)C(=C(O)c2cc(Br)ccc2O)C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H31BrN2O7/c1-6-28(7-2)10-11-29-22(15-12-19(34-3)25(36-5)20(13-15)35-4)21(24(32)26(29)33)23(31)17-14-16(27)8-9-18(17)30/h8-9,12-14,22,30-31H,6-7,10-11H2,1-5H3 |
| InChIKey | BOPKFQHAODKMFX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|