C14H12ClN3O2S — CID 163331219
2-(4-oxo-1,3-thiazol-2-yl)-N-quinolin-8-ylacetamide;hydrochloride (PubChem CID 163331219) has the molecular formula C14H12ClN3O2S and a molecular weight of 321.79 g/mol. Its IUPAC name is 2-(4-oxo-1,3-thiazol-2-yl)-N-quinolin-8-ylacetamide;hydrochloride.
| Compound Name | 2-(4-oxo-1,3-thiazol-2-yl)-N-quinolin-8-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 163331219 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-(4-oxo-1,3-thiazol-2-yl)-N-quinolin-8-ylacetamide;hydrochloride |
| SMILES | Cl.O=C1CSC(CC(=O)Nc2cccc3cccnc23)=N1 |
| InChI | InChI=1S/C14H11N3O2S.ClH/c18-11(7-13-17-12(19)8-20-13)16-10-5-1-3-9-4-2-6-15-14(9)10;/h1-6H,7-8H2,(H,16,18);1H |
| InChIKey | SMXMWDWOPNLCAZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |