C22H28N2O6 — CID 163333635
2-[(2S,4R)-2-ethyl-4-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]quinoline-4-carboxylic acid;formic acid (PubChem CID 163333635) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-[(2S,4R)-2-ethyl-4-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]quinoline-4-carboxylic acid;formic acid.
| Compound Name | 2-[(2S,4R)-2-ethyl-4-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]quinoline-4-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 163333635 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-[(2S,4R)-2-ethyl-4-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]quinoline-4-carboxylic acid;formic acid |
| SMILES | CC[C@H]1C[C@@H](O)CC2(CCN(c3cc(C(=O)O)c4ccccc4n3)CC2)O1.O=CO |
| InChI | InChI=1S/C21H26N2O4.CH2O2/c1-2-15-11-14(24)13-21(27-15)7-9-23(10-8-21)19-12-17(20(25)26)16-5-3-4-6-18(16)22-19;2-1-3/h3-6,12,14-15,24H,2,7-11,13H2,1H3,(H,25,26);1H,(H,2,3)/t14-,15+;/m1./s1 |
| InChIKey | OFWVBDLTXYAOBE-LIOBNPLQSA-N |
| XLogP | 2.92 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|