C21H24N4O4 — CID 166619103
2-[1-(2-methylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]quinoline-4-carboxylic acid (PubChem CID 166619103) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[1-(2-methylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]quinoline-4-carboxylic acid.
| Compound Name | 2-[1-(2-methylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 166619103 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[1-(2-methylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]quinoline-4-carboxylic acid |
| SMILES | CC(C)CN1C(=O)NC(=O)C12CCN(c1cc(C(=O)O)c3ccccc3n1)CC2 |
| InChI | InChI=1S/C21H24N4O4/c1-13(2)12-25-20(29)23-19(28)21(25)7-9-24(10-8-21)17-11-15(18(26)27)14-5-3-4-6-16(14)22-17/h3-6,11,13H,7-10,12H2,1-2H3,(H,26,27)(H,23,28,29) |
| InChIKey | UISMSZDNCQCJCO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|